C24H29F2NO — CID 15008036
2-(2,6-difluorophenyl)-4-(2-methyl-4-octylphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 15008036) has the molecular formula C24H29F2NO and a molecular weight of 385.50 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-(2-methyl-4-octylphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(2,6-difluorophenyl)-4-(2-methyl-4-octylphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 15008036 |
| Molecular Formula | C24H29F2NO |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-(2-methyl-4-octylphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCCCc1ccc(C2COC(c3c(F)cccc3F)=N2)c(C)c1 |
| InChI | InChI=1S/C24H29F2NO/c1-3-4-5-6-7-8-10-18-13-14-19(17(2)15-18)22-16-28-24(27-22)23-20(25)11-9-12-21(23)26/h9,11-15,22H,3-8,10,16H2,1-2H3 |
| InChIKey | HTULNQDSIKQNGB-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|