C25H30ClF2NO — CID 15008044
4-(2-chloro-4-decylphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 15008044) has the molecular formula C25H30ClF2NO and a molecular weight of 433.97 g/mol. Its IUPAC name is 4-(2-chloro-4-decylphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-(2-chloro-4-decylphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 15008044 |
| Molecular Formula | C25H30ClF2NO |
| Molecular Weight | 433.97 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 4-(2-chloro-4-decylphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCCCCCc1ccc(C2COC(c3c(F)cccc3F)=N2)c(Cl)c1 |
| InChI | InChI=1S/C25H30ClF2NO/c1-2-3-4-5-6-7-8-9-11-18-14-15-19(20(26)16-18)23-17-30-25(29-23)24-21(27)12-10-13-22(24)28/h10,12-16,23H,2-9,11,17H2,1H3 |
| InChIKey | BRUXXRITIKGQGB-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.97 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|