C26H33F2NO2 — CID 15008045
4-(4-decyl-2-methoxyphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 15008045) has the molecular formula C26H33F2NO2 and a molecular weight of 429.55 g/mol. Its IUPAC name is 4-(4-decyl-2-methoxyphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-(4-decyl-2-methoxyphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 15008045 |
| Molecular Formula | C26H33F2NO2 |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 4-(4-decyl-2-methoxyphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCCCCCc1ccc(C2COC(c3c(F)cccc3F)=N2)c(OC)c1 |
| InChI | InChI=1S/C26H33F2NO2/c1-3-4-5-6-7-8-9-10-12-19-15-16-20(24(17-19)30-2)23-18-31-26(29-23)25-21(27)13-11-14-22(25)28/h11,13-17,23H,3-10,12,18H2,1-2H3 |
| InChIKey | KDUODCMJNKMQFI-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|