C21H20F3N3O2 — CID 15008422
3-ethyl-1-methyl-N-[[4-[4-(trifluoromethyl)phenoxy]phenyl]methyl]pyrazole-5-carboxamide (PubChem CID 15008422) has the molecular formula C21H20F3N3O2 and a molecular weight of 403.40 g/mol. Its IUPAC name is 3-ethyl-1-methyl-N-[[4-[4-(trifluoromethyl)phenoxy]phenyl]methyl]pyrazole-5-carboxamide.
| Compound Name | 3-ethyl-1-methyl-N-[[4-[4-(trifluoromethyl)phenoxy]phenyl]methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 15008422 |
| Molecular Formula | C21H20F3N3O2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3-ethyl-1-methyl-N-[[4-[4-(trifluoromethyl)phenoxy]phenyl]methyl]pyrazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)NCc2ccc(Oc3ccc(C(F)(F)F)cc3)cc2)n(C)n1 |
| InChI | InChI=1S/C21H20F3N3O2/c1-3-16-12-19(27(2)26-16)20(28)25-13-14-4-8-17(9-5-14)29-18-10-6-15(7-11-18)21(22,23)24/h4-12H,3,13H2,1-2H3,(H,25,28) |
| InChIKey | XFHPXNDSRQIEQO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |