About 1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol
1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol (PubChem CID 150085077) has the molecular formula C34H35F2N3O2
and a molecular weight of 555.67 g/mol. Its IUPAC name is 1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol |
| PubChem CID | 150085077 |
| Molecular Formula | C34H35F2N3O2 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol |
| SMILES | CC(C)(C)NCC(O)COC(Cn1c2ccccc2c2cc(F)ccc21)Cn1c2ccccc2c2cc(F)ccc21 |
| InChI | InChI=1S/C34H35F2N3O2/c1-34(2,3)37-18-24(40)21-41-25(19-38-30-10-6-4-8-26(30)28-16-22(35)12-14-32(28)38)20-39-31-11-7-5-9-27(31)29-17-23(36)13-15-33(29)39/h4-17,24-25,37,40H,18-21H2,1-3H3 |
| InChIKey | DSBDHXHYJBERRD-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 51.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol?
The IUPAC name of 1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol (CID 150085077) is 1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol.
What is the SMILES notation for 1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol?
The canonical SMILES for 1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol is CC(C)(C)NCC(O)COC(Cn1c2ccccc2c2cc(F)ccc21)Cn1c2ccccc2c2cc(F)ccc21.
What is the InChIKey of 1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol?
The InChIKey is DSBDHXHYJBERRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H35F2N3O2/c1-34(2,3)37-18-24(40)21-41-25(19-38-30-10-6-4-8-26(30)28-16-22(35)12-14-32(28)38)20-39-31-11-7-5-9-27(31)29-17-23(36)13-15-33(29)39/h4-17,24-25,37,40H,18-21H2,1-3H3.
What are the key properties of 1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol?
1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol has a molecular weight of 555.67 g/mol, XLogP of 7.01, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,3-bis(3-fluorocarbazol-9-yl)propan-2-yloxy]-3-(tert-butylamino)propan-2-ol is sourced from PubChem (CID 150085077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).