C26H30N2O2 — CID 150085574
ethyl 2-[4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]acetate (PubChem CID 150085574) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is ethyl 2-[4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 150085574 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | ethyl 2-[4-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2CCC(N[C@H](C)c3cccc4ccccc34)C2)cc1 |
| InChI | InChI=1S/C26H30N2O2/c1-3-30-26(29)17-20-11-13-23(14-12-20)28-16-15-22(18-28)27-19(2)24-10-6-8-21-7-4-5-9-25(21)24/h4-14,19,22,27H,3,15-18H2,1-2H3/t19-,22?/m1/s1 |
| InChIKey | DSDQMTYRGQOIEX-LCQOSCCDSA-N |
| XLogP | 4.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|