C22H36BN3O5 — CID 150087816
2-amino-6-borono-2-[1-(5,5-dimethyl-3-oxo-2,6,7,8-tetrahydroisoquinolin-8-yl)piperidin-4-yl]hexanoic acid (PubChem CID 150087816) has the molecular formula C22H36BN3O5 and a molecular weight of 433.36 g/mol. Its IUPAC name is 2-amino-6-borono-2-[1-(5,5-dimethyl-3-oxo-2,6,7,8-tetrahydroisoquinolin-8-yl)piperidin-4-yl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[1-(5,5-dimethyl-3-oxo-2,6,7,8-tetrahydroisoquinolin-8-yl)piperidin-4-yl]hexanoic acid |
|---|---|
| PubChem CID | 150087816 |
| Molecular Formula | C22H36BN3O5 |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 2-amino-6-borono-2-[1-(5,5-dimethyl-3-oxo-2,6,7,8-tetrahydroisoquinolin-8-yl)piperidin-4-yl]hexanoic acid |
| SMILES | CC1(C)CCC(N2CCC(C(N)(CCCCB(O)O)C(=O)O)CC2)c2c[nH]c(=O)cc21 |
| InChI | InChI=1S/C22H36BN3O5/c1-21(2)9-5-18(16-14-25-19(27)13-17(16)21)26-11-6-15(7-12-26)22(24,20(28)29)8-3-4-10-23(30)31/h13-15,18,30-31H,3-12,24H2,1-2H3,(H,25,27)(H,28,29) |
| InChIKey | DSPGCKGPIAWMKI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|