About 1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one
1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one (PubChem CID 150091015) has the molecular formula C16H14F3N3O
and a molecular weight of 321.30 g/mol. Its IUPAC name is 1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one |
| PubChem CID | 150091015 |
| Molecular Formula | C16H14F3N3O |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one |
| SMILES | O=C1N(c2ccc(CC(F)(F)F)cc2)CCN1c1cccnc1 |
| InChI | InChI=1S/C16H14F3N3O/c17-16(18,19)10-12-3-5-13(6-4-12)21-8-9-22(15(21)23)14-2-1-7-20-11-14/h1-7,11H,8-10H2 |
| InChIKey | DTFPMOUBXMLQSS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one?
The IUPAC name of 1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one (CID 150091015) is 1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one.
What is the SMILES notation for 1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one?
The canonical SMILES for 1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one is O=C1N(c2ccc(CC(F)(F)F)cc2)CCN1c1cccnc1.
What is the InChIKey of 1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one?
The InChIKey is DTFPMOUBXMLQSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3N3O/c17-16(18,19)10-12-3-5-13(6-4-12)21-8-9-22(15(21)23)14-2-1-7-20-11-14/h1-7,11H,8-10H2.
What are the key properties of 1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one?
1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one has a molecular weight of 321.30 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-3-yl-3-[4-(2,2,2-trifluoroethyl)phenyl]imidazolidin-2-one is sourced from PubChem (CID 150091015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).