C19H16Cl4F2O — CID 150091760
1,3,5,7-tetrachloro-1,7-bis(4-fluorophenyl)heptan-4-one (PubChem CID 150091760) has the molecular formula C19H16Cl4F2O and a molecular weight of 440.14 g/mol. Its IUPAC name is 1,3,5,7-tetrachloro-1,7-bis(4-fluorophenyl)heptan-4-one.
| Compound Name | 1,3,5,7-tetrachloro-1,7-bis(4-fluorophenyl)heptan-4-one |
|---|---|
| PubChem CID | 150091760 |
| Molecular Formula | C19H16Cl4F2O |
| Molecular Weight | 440.14 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 1,3,5,7-tetrachloro-1,7-bis(4-fluorophenyl)heptan-4-one |
| SMILES | O=C(C(Cl)CC(Cl)c1ccc(F)cc1)C(Cl)CC(Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16Cl4F2O/c20-15(11-1-5-13(24)6-2-11)9-17(22)19(26)18(23)10-16(21)12-3-7-14(25)8-4-12/h1-8,15-18H,9-10H2 |
| InChIKey | DTJDXOMHDPLHCU-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.14 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|