C23H22N4O4 — CID 150093925
8,9,20-trimethoxy-22,23-dihydroporphyrin-1-ol (PubChem CID 150093925) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 8,9,20-trimethoxy-22,23-dihydroporphyrin-1-ol.
| Compound Name | 8,9,20-trimethoxy-22,23-dihydroporphyrin-1-ol |
|---|---|
| PubChem CID | 150093925 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 8,9,20-trimethoxy-22,23-dihydroporphyrin-1-ol |
| SMILES | COC1=CC2=CC3=NC(O)(C=C3)C(OC)=C3C=CC(=N3)C=c3ccc([nH]3)=CC1(OC)N2 |
| InChI | InChI=1S/C23H22N4O4/c1-29-20-12-18-11-16-8-9-22(28,26-16)21(30-2)19-7-6-15(25-19)10-14-4-5-17(24-14)13-23(20,27-18)31-3/h4-13,24,27-28H,1-3H3 |
| InChIKey | GGQZMMOXKWWNEP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |