C22H28N4O3 — CID 15010010
8-[cyclopropyl-(4-methoxyphenyl)methyl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 15010010) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 8-[cyclopropyl-(4-methoxyphenyl)methyl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[cyclopropyl-(4-methoxyphenyl)methyl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 15010010 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 8-[cyclopropyl-(4-methoxyphenyl)methyl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(C(c3ccc(OC)cc3)C3CC3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C22H28N4O3/c1-4-12-25-20-18(21(27)26(13-5-2)22(25)28)23-19(24-20)17(14-6-7-14)15-8-10-16(29-3)11-9-15/h8-11,14,17H,4-7,12-13H2,1-3H3,(H,23,24) |
| InChIKey | KCKCLVOXBVFOGG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |