C21H25FN4O2 — CID 15010011
8-[cyclopropyl-(4-fluorophenyl)methyl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 15010011) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is 8-[cyclopropyl-(4-fluorophenyl)methyl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[cyclopropyl-(4-fluorophenyl)methyl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 15010011 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 8-[cyclopropyl-(4-fluorophenyl)methyl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(C(c3ccc(F)cc3)C3CC3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C21H25FN4O2/c1-3-11-25-19-17(20(27)26(12-4-2)21(25)28)23-18(24-19)16(13-5-6-13)14-7-9-15(22)10-8-14/h7-10,13,16H,3-6,11-12H2,1-2H3,(H,23,24) |
| InChIKey | GDGUEXHQRZLZNJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |