About 4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one
4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one (PubChem CID 150103020) has the molecular formula C11H12ClNO2
and a molecular weight of 225.68 g/mol. Its IUPAC name is 4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one.
Molecular Properties
| Compound Name | 4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one |
| PubChem CID | 150103020 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one |
| SMILES | O=C1CN(CCCCl)c2ccccc2O1 |
| InChI | InChI=1S/C11H12ClNO2/c12-6-3-7-13-8-11(14)15-10-5-2-1-4-9(10)13/h1-2,4-5H,3,6-8H2 |
| InChIKey | DVQQNFNFJJPPOY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one?
The IUPAC name of 4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one (CID 150103020) is 4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one.
What is the SMILES notation for 4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one?
The canonical SMILES for 4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one is O=C1CN(CCCCl)c2ccccc2O1.
What is the InChIKey of 4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one?
The InChIKey is DVQQNFNFJJPPOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO2/c12-6-3-7-13-8-11(14)15-10-5-2-1-4-9(10)13/h1-2,4-5H,3,6-8H2.
What are the key properties of 4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one?
4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one has a molecular weight of 225.68 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloropropyl)-3H-1,4-benzoxazin-2-one is sourced from PubChem (CID 150103020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).