About (1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid
(1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 150104051) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is (1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid.
Molecular Properties
| Compound Name | (1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid |
| PubChem CID | 150104051 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CN1C[C@@H]2C[C@@H]1CN2C(=O)O |
| InChI | InChI=1S/C7H12N2O2/c1-8-3-6-2-5(8)4-9(6)7(10)11/h5-6H,2-4H2,1H3,(H,10,11)/t5-,6+/m1/s1 |
| InChIKey | DVWBCAFQMLLSNA-RITPCOANSA-N |
| XLogP | 0.05 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid?
The IUPAC name of (1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid (CID 150104051) is (1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid.
What is the SMILES notation for (1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid?
The canonical SMILES for (1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid is CN1C[C@@H]2C[C@@H]1CN2C(=O)O.
What is the InChIKey of (1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid?
The InChIKey is DVWBCAFQMLLSNA-RITPCOANSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-8-3-6-2-5(8)4-9(6)7(10)11/h5-6H,2-4H2,1H3,(H,10,11)/t5-,6+/m1/s1.
What are the key properties of (1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid?
(1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid has a molecular weight of 156.18 g/mol, XLogP of 0.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid is sourced from PubChem (CID 150104051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).