C26H36O2 — CID 150104284
2-(1-adamantyl)propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-4-ene-4-carboxylate (PubChem CID 150104284) has the molecular formula C26H36O2 and a molecular weight of 380.57 g/mol. Its IUPAC name is 2-(1-adamantyl)propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-4-ene-4-carboxylate.
| Compound Name | 2-(1-adamantyl)propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-4-ene-4-carboxylate |
|---|---|
| PubChem CID | 150104284 |
| Molecular Formula | C26H36O2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 2-(1-adamantyl)propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-4-ene-4-carboxylate |
| SMILES | CC(C)(OC(=O)C1=CC2CC1C1C3CCC(C3)C21)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H36O2/c1-25(2,26-11-14-5-15(12-26)7-16(6-14)13-26)28-24(27)21-10-19-9-20(21)23-18-4-3-17(8-18)22(19)23/h10,14-20,22-23H,3-9,11-13H2,1-2H3 |
| InChIKey | DVXGTCLVEUDAAW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|