About (2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate
(2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate (PubChem CID 150109439) has the molecular formula C22H32O4S
and a molecular weight of 392.56 g/mol. Its IUPAC name is (2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate.
Molecular Properties
| Compound Name | (2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate |
| PubChem CID | 150109439 |
| Molecular Formula | C22H32O4S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate |
| SMILES | CC(=O)Oc1c(C(C)(C)C)cc2c(c1C(C)(C)C)C(C)C(C)(OC(C)=O)S2 |
| InChI | InChI=1S/C22H32O4S/c1-12-17-16(27-22(12,10)26-14(3)24)11-15(20(4,5)6)19(25-13(2)23)18(17)21(7,8)9/h11-12H,1-10H3 |
| InChIKey | DWXYWAXIWOACHA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate?
The IUPAC name of (2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate (CID 150109439) is (2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate.
What is the SMILES notation for (2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate?
The canonical SMILES for (2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate is CC(=O)Oc1c(C(C)(C)C)cc2c(c1C(C)(C)C)C(C)C(C)(OC(C)=O)S2.
What is the InChIKey of (2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate?
The InChIKey is DWXYWAXIWOACHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32O4S/c1-12-17-16(27-22(12,10)26-14(3)24)11-15(20(4,5)6)19(25-13(2)23)18(17)21(7,8)9/h11-12H,1-10H3.
What are the key properties of (2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate?
(2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate has a molecular weight of 392.56 g/mol, XLogP of 5.70, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetyloxy-4,6-ditert-butyl-2,3-dimethyl-3H-1-benzothiophen-5-yl) acetate is sourced from PubChem (CID 150109439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).