C10H21NO — CID 150111036
(E,2S,3R,4R)-4-methyl-2-(methylamino)oct-6-en-3-ol (PubChem CID 150111036) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is (E,2S,3R,4R)-4-methyl-2-(methylamino)oct-6-en-3-ol.
| Compound Name | (E,2S,3R,4R)-4-methyl-2-(methylamino)oct-6-en-3-ol |
|---|---|
| PubChem CID | 150111036 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (E,2S,3R,4R)-4-methyl-2-(methylamino)oct-6-en-3-ol |
| SMILES | C/C=C/C[C@@H](C)[C@@H](O)[C@H](C)NC |
| InChI | InChI=1S/C10H21NO/c1-5-6-7-8(2)10(12)9(3)11-4/h5-6,8-12H,7H2,1-4H3/b6-5+/t8-,9+,10-/m1/s1 |
| InChIKey | DXGHQJVKZMEKLX-RNWMEYJFSA-N |
| XLogP | 1.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|