C16H24BFN2O3 — CID 150118868
6-fluoro-N-(oxolan-3-ylmethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 150118868) has the molecular formula C16H24BFN2O3 and a molecular weight of 322.19 g/mol. Its IUPAC name is 6-fluoro-N-(oxolan-3-ylmethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 6-fluoro-N-(oxolan-3-ylmethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 150118868 |
| Molecular Formula | C16H24BFN2O3 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 6-fluoro-N-(oxolan-3-ylmethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | CC1(C)OB(c2ccc(NCC3CCOC3)nc2F)OC1(C)C |
| InChI | InChI=1S/C16H24BFN2O3/c1-15(2)16(3,4)23-17(22-15)12-5-6-13(20-14(12)18)19-9-11-7-8-21-10-11/h5-6,11H,7-10H2,1-4H3,(H,19,20) |
| InChIKey | DYUYJVMRMJVUIC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|