C22H26O6 — CID 150125719
3-methoxy-6-(1,2,3-trimethoxy-7,8,9,10-tetrahydrobenzo[8]annulen-4-yl)benzene-1,2-diol (PubChem CID 150125719) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is 3-methoxy-6-(1,2,3-trimethoxy-7,8,9,10-tetrahydrobenzo[8]annulen-4-yl)benzene-1,2-diol.
| Compound Name | 3-methoxy-6-(1,2,3-trimethoxy-7,8,9,10-tetrahydrobenzo[8]annulen-4-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 150125719 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-methoxy-6-(1,2,3-trimethoxy-7,8,9,10-tetrahydrobenzo[8]annulen-4-yl)benzene-1,2-diol |
| SMILES | COc1ccc(-c2c3c(c(OC)c(OC)c2OC)CCCCC=C3)c(O)c1O |
| InChI | InChI=1S/C22H26O6/c1-25-16-12-11-15(18(23)19(16)24)17-13-9-7-5-6-8-10-14(13)20(26-2)22(28-4)21(17)27-3/h7,9,11-12,23-24H,5-6,8,10H2,1-4H3 |
| InChIKey | FAEJHDKVJUXZGV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|