C8H14IN3O — CID 150127688
2-ethyl-3,6,7,8-tetrahydro-2H-imidazo[1,5-c]pyrimidin-2-ium-5-one iodide (PubChem CID 150127688) has the molecular formula C8H14IN3O and a molecular weight of 295.12 g/mol. Its IUPAC name is 2-ethyl-3,6,7,8-tetrahydro-2H-imidazo[1,5-c]pyrimidin-2-ium-5-one iodide.
| Compound Name | 2-ethyl-3,6,7,8-tetrahydro-2H-imidazo[1,5-c]pyrimidin-2-ium-5-one iodide |
|---|---|
| PubChem CID | 150127688 |
| Molecular Formula | C8H14IN3O |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 2-ethyl-3,6,7,8-tetrahydro-2H-imidazo[1,5-c]pyrimidin-2-ium-5-one iodide |
| SMILES | CC[NH+]1C=C2CCNC(=O)N2C1.[I-] |
| InChI | InChI=1S/C8H13N3O.HI/c1-2-10-5-7-3-4-9-8(12)11(7)6-10;/h5H,2-4,6H2,1H3,(H,9,12);1H |
| InChIKey | BQZYWTBNMYOKTA-UHFFFAOYSA-N |
| XLogP | -3.88 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|