About 2-ethoxy-8-methyl-3,4-dihydro-2H-chromene
2-ethoxy-8-methyl-3,4-dihydro-2H-chromene (PubChem CID 15012842) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-ethoxy-8-methyl-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 2-ethoxy-8-methyl-3,4-dihydro-2H-chromene |
| PubChem CID | 15012842 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-ethoxy-8-methyl-3,4-dihydro-2H-chromene |
| SMILES | CCOC1CCc2cccc(C)c2O1 |
| InChI | InChI=1S/C12H16O2/c1-3-13-11-8-7-10-6-4-5-9(2)12(10)14-11/h4-6,11H,3,7-8H2,1-2H3 |
| InChIKey | MTPNYOAFDZSWIM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxy-8-methyl-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-8-methyl-3,4-dihydro-2H-chromene?
The IUPAC name of 2-ethoxy-8-methyl-3,4-dihydro-2H-chromene (CID 15012842) is 2-ethoxy-8-methyl-3,4-dihydro-2H-chromene.
What is the SMILES notation for 2-ethoxy-8-methyl-3,4-dihydro-2H-chromene?
The canonical SMILES for 2-ethoxy-8-methyl-3,4-dihydro-2H-chromene is CCOC1CCc2cccc(C)c2O1.
What is the InChIKey of 2-ethoxy-8-methyl-3,4-dihydro-2H-chromene?
The InChIKey is MTPNYOAFDZSWIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-3-13-11-8-7-10-6-4-5-9(2)12(10)14-11/h4-6,11H,3,7-8H2,1-2H3.
What are the key properties of 2-ethoxy-8-methyl-3,4-dihydro-2H-chromene?
2-ethoxy-8-methyl-3,4-dihydro-2H-chromene has a molecular weight of 192.26 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-8-methyl-3,4-dihydro-2H-chromene is sourced from PubChem (CID 15012842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).