C29H30ClN5O2S — CID 150128947
10-(3,5-dimethyltriazol-4-yl)-7-[(S)-oxan-4-yl(phenyl)methyl]-5-propan-2-yl-3-thia-7,12-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene-4-carbonyl chloride (PubChem CID 150128947) has the molecular formula C29H30ClN5O2S and a molecular weight of 548.11 g/mol. Its IUPAC name is 10-(3,5-dimethyltriazol-4-yl)-7-[(S)-oxan-4-yl(phenyl)methyl]-5-propan-2-yl-3-thia-7,12-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene-4-carbonyl chloride.
| Compound Name | 10-(3,5-dimethyltriazol-4-yl)-7-[(S)-oxan-4-yl(phenyl)methyl]-5-propan-2-yl-3-thia-7,12-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene-4-carbonyl chloride |
|---|---|
| PubChem CID | 150128947 |
| Molecular Formula | C29H30ClN5O2S |
| Molecular Weight | 548.11 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 10-(3,5-dimethyltriazol-4-yl)-7-[(S)-oxan-4-yl(phenyl)methyl]-5-propan-2-yl-3-thia-7,12-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene-4-carbonyl chloride |
| SMILES | Cc1nnn(C)c1-c1cnc2c3sc(C(=O)Cl)c(C(C)C)c3n([C@H](c3ccccc3)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C29H30ClN5O2S/c1-16(2)22-26-28(38-27(22)29(30)36)23-21(14-20(15-31-23)24-17(3)32-33-34(24)4)35(26)25(18-8-6-5-7-9-18)19-10-12-37-13-11-19/h5-9,14-16,19,25H,10-13H2,1-4H3/t25-/m1/s1 |
| InChIKey | FAVDYNZMKLNAMY-RUZDIDTESA-N |
| XLogP | 6.87 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.11 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|