About 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine
2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 15012906) has the molecular formula C8H8ClN
and a molecular weight of 153.61 g/mol. Its IUPAC name is 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine.
Molecular Properties
| Compound Name | 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine |
| PubChem CID | 15012906 |
| Molecular Formula | C8H8ClN |
| Molecular Weight | 153.61 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | Clc1ccc2c(n1)CCC2 |
| InChI | InChI=1S/C8H8ClN/c9-8-5-4-6-2-1-3-7(6)10-8/h4-5H,1-3H2 |
| InChIKey | PBMLTRUXYZHCFT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.61 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine?
The IUPAC name of 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine (CID 15012906) is 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine.
What is the SMILES notation for 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine?
The canonical SMILES for 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine is Clc1ccc2c(n1)CCC2.
What is the InChIKey of 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine?
The InChIKey is PBMLTRUXYZHCFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN/c9-8-5-4-6-2-1-3-7(6)10-8/h4-5H,1-3H2.
What are the key properties of 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine?
2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine has a molecular weight of 153.61 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine is sourced from PubChem (CID 15012906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).