C21H23N3O2 — CID 15012932
(4R,5R)-4-[(1S)-1-azido-2-phenylethyl]-2,2-dimethyl-5-[(E)-2-phenylethenyl]-1,3-dioxolane (PubChem CID 15012932) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (4R,5R)-4-[(1S)-1-azido-2-phenylethyl]-2,2-dimethyl-5-[(E)-2-phenylethenyl]-1,3-dioxolane.
| Compound Name | (4R,5R)-4-[(1S)-1-azido-2-phenylethyl]-2,2-dimethyl-5-[(E)-2-phenylethenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 15012932 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (4R,5R)-4-[(1S)-1-azido-2-phenylethyl]-2,2-dimethyl-5-[(E)-2-phenylethenyl]-1,3-dioxolane |
| SMILES | CC1(C)O[C@H]([C@H](Cc2ccccc2)N=[N+]=[N-])[C@@H](/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C21H23N3O2/c1-21(2)25-19(14-13-16-9-5-3-6-10-16)20(26-21)18(23-24-22)15-17-11-7-4-8-12-17/h3-14,18-20H,15H2,1-2H3/b14-13+/t18-,19+,20+/m0/s1 |
| InChIKey | WJAJHUWPVPCQTR-XKTFHJRVSA-N |
| XLogP | 5.14 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|