C7H5N5 — CID 150132733
3,4,5,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,9-pentaene (PubChem CID 150132733) has the molecular formula C7H5N5 and a molecular weight of 159.15 g/mol. Its IUPAC name is 3,4,5,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,9-pentaene.
| Compound Name | 3,4,5,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,9-pentaene |
|---|---|
| PubChem CID | 150132733 |
| Molecular Formula | C7H5N5 |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 3,4,5,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,9-pentaene |
| SMILES | C1=c2c(ncc3n[nH]nc23)=NC1 |
| InChI | InChI=1S/C7H5N5/c1-2-8-7-4(1)6-5(3-9-7)10-12-11-6/h1,3H,2H2,(H,10,11,12) |
| InChIKey | PBDUXXBNKNJQKH-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |