About butane;niobium(2+)
butane;niobium(2+) (PubChem CID 150133889) has the molecular formula C8H18Nb
and a molecular weight of 207.14 g/mol. Its IUPAC name is butane;niobium(2+).
Molecular Properties
| Compound Name | butane;niobium(2+) |
| PubChem CID | 150133889 |
| Molecular Formula | C8H18Nb |
| Molecular Weight | 207.14 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | butane;niobium(2+) |
| SMILES | [CH2-]CCC.[CH2-]CCC.[Nb+2] |
| InChI | InChI=1S/2C4H9.Nb/c2*1-3-4-2;/h2*1,3-4H2,2H3;/q2*-1;+2 |
| InChIKey | FBVCKRYSXPRLFA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.14 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze butane;niobium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;niobium(2+)?
The IUPAC name of butane;niobium(2+) (CID 150133889) is butane;niobium(2+).
What is the SMILES notation for butane;niobium(2+)?
The canonical SMILES for butane;niobium(2+) is [CH2-]CCC.[CH2-]CCC.[Nb+2].
What is the InChIKey of butane;niobium(2+)?
The InChIKey is FBVCKRYSXPRLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H9.Nb/c2*1-3-4-2;/h2*1,3-4H2,2H3;/q2*-1;+2.
What are the key properties of butane;niobium(2+)?
butane;niobium(2+) has a molecular weight of 207.14 g/mol, XLogP of 3.24, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;niobium(2+) is sourced from PubChem (CID 150133889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).