About 5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane]
5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane] (PubChem CID 150135063) has the molecular formula C28H23NO2
and a molecular weight of 405.50 g/mol. Its IUPAC name is 5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane].
Molecular Properties
| Compound Name | 5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane] |
| PubChem CID | 150135063 |
| Molecular Formula | C28H23NO2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane] |
| SMILES | O=[N+]([O-])c1ccccc1-c1cc2c(c3ccccc13)-c1ccccc1C21CCCCC1 |
| InChI | InChI=1S/C28H23NO2/c30-29(31)26-15-7-5-11-20(26)23-18-25-27(21-12-3-2-10-19(21)23)22-13-4-6-14-24(22)28(25)16-8-1-9-17-28/h2-7,10-15,18H,1,8-9,16-17H2 |
| InChIKey | FCBIMSPKNAVHLD-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane]?
The IUPAC name of 5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane] (CID 150135063) is 5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane].
What is the SMILES notation for 5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane]?
The canonical SMILES for 5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane] is O=[N+]([O-])c1ccccc1-c1cc2c(c3ccccc13)-c1ccccc1C21CCCCC1.
What is the InChIKey of 5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane]?
The InChIKey is FCBIMSPKNAVHLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H23NO2/c30-29(31)26-15-7-5-11-20(26)23-18-25-27(21-12-3-2-10-19(21)23)22-13-4-6-14-24(22)28(25)16-8-1-9-17-28/h2-7,10-15,18H,1,8-9,16-17H2.
What are the key properties of 5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane]?
5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane] has a molecular weight of 405.50 g/mol, XLogP of 7.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-nitrophenyl)spiro[benzo[c]fluorene-7,1'-cyclohexane] is sourced from PubChem (CID 150135063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).