C10H9N3O6 — CID 15013607
7-nitro-3-oxido-4,10,15-trioxa-5-aza-3-azoniatricyclo[7.6.0.02,6]pentadeca-1(9),2,5,7-tetraene (PubChem CID 15013607) has the molecular formula C10H9N3O6 and a molecular weight of 267.20 g/mol. Its IUPAC name is 7-nitro-3-oxido-4,10,15-trioxa-5-aza-3-azoniatricyclo[7.6.0.02,6]pentadeca-1(9),2,5,7-tetraene.
| Compound Name | 7-nitro-3-oxido-4,10,15-trioxa-5-aza-3-azoniatricyclo[7.6.0.02,6]pentadeca-1(9),2,5,7-tetraene |
|---|---|
| PubChem CID | 15013607 |
| Molecular Formula | C10H9N3O6 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 7-nitro-3-oxido-4,10,15-trioxa-5-aza-3-azoniatricyclo[7.6.0.02,6]pentadeca-1(9),2,5,7-tetraene |
| SMILES | O=[N+]([O-])c1cc2c(c3c1no[n+]3[O-])OCCCCO2 |
| InChI | InChI=1S/C10H9N3O6/c14-12(15)6-5-7-10(18-4-2-1-3-17-7)9-8(6)11-19-13(9)16/h5H,1-4H2 |
| InChIKey | WRYVNZLVDXJCAJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 114.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|