About spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione
spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione (PubChem CID 150136371) has the molecular formula C10H6O4S
and a molecular weight of 222.22 g/mol. Its IUPAC name is spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione.
Molecular Properties
| Compound Name | spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione |
| PubChem CID | 150136371 |
| Molecular Formula | C10H6O4S |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione |
| SMILES | O=C1OC(=O)C12Cc1ccccc1SO2 |
| InChI | InChI=1S/C10H6O4S/c11-8-10(9(12)13-8)5-6-3-1-2-4-7(6)15-14-10/h1-4H,5H2 |
| InChIKey | FCICZOUHBCNPIQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione?
The IUPAC name of spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione (CID 150136371) is spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione.
What is the SMILES notation for spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione?
The canonical SMILES for spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione is O=C1OC(=O)C12Cc1ccccc1SO2.
What is the InChIKey of spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione?
The InChIKey is FCICZOUHBCNPIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O4S/c11-8-10(9(12)13-8)5-6-3-1-2-4-7(6)15-14-10/h1-4H,5H2.
What are the key properties of spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione?
spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione has a molecular weight of 222.22 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4H-2,1-benzoxathiine-3,3'-oxetane]-2',4'-dione is sourced from PubChem (CID 150136371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).