C26H19FN6 — CID 150136429
5-[2-[4-(2-aminopyrimidin-5-yl)-3-fluoro-5-phenylphenyl]phenyl]pyrimidin-2-amine (PubChem CID 150136429) has the molecular formula C26H19FN6 and a molecular weight of 434.48 g/mol. Its IUPAC name is 5-[2-[4-(2-aminopyrimidin-5-yl)-3-fluoro-5-phenylphenyl]phenyl]pyrimidin-2-amine.
| Compound Name | 5-[2-[4-(2-aminopyrimidin-5-yl)-3-fluoro-5-phenylphenyl]phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 150136429 |
| Molecular Formula | C26H19FN6 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 5-[2-[4-(2-aminopyrimidin-5-yl)-3-fluoro-5-phenylphenyl]phenyl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2ccccc2-c2cc(F)c(-c3cnc(N)nc3)c(-c3ccccc3)c2)cn1 |
| InChI | InChI=1S/C26H19FN6/c27-23-11-17(20-8-4-5-9-21(20)18-12-30-25(28)31-13-18)10-22(16-6-2-1-3-7-16)24(23)19-14-32-26(29)33-15-19/h1-15H,(H2,28,30,31)(H2,29,32,33) |
| InChIKey | FCILMPJUUWCHHA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |