C35H40N4O6S — CID 15013783
N-(cyclopentylmethyl)-1-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-3-[3-(methylamino)-3-oxopropyl]indole-6-carboxamide (PubChem CID 15013783) has the molecular formula C35H40N4O6S and a molecular weight of 644.79 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-1-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-3-[3-(methylamino)-3-oxopropyl]indole-6-carboxamide.
| Compound Name | N-(cyclopentylmethyl)-1-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-3-[3-(methylamino)-3-oxopropyl]indole-6-carboxamide |
|---|---|
| PubChem CID | 15013783 |
| Molecular Formula | C35H40N4O6S |
| Molecular Weight | 644.79 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | N-(cyclopentylmethyl)-1-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-3-[3-(methylamino)-3-oxopropyl]indole-6-carboxamide |
| SMILES | CNC(=O)CCc1cn(Cc2ccc(C(=O)NS(=O)(=O)c3ccccc3C)cc2OC)c2cc(C(=O)NCC3CCCC3)ccc12 |
| InChI | InChI=1S/C35H40N4O6S/c1-23-8-4-7-11-32(23)46(43,44)38-35(42)26-12-13-28(31(19-26)45-3)22-39-21-27(15-17-33(40)36-2)29-16-14-25(18-30(29)39)34(41)37-20-24-9-5-6-10-24/h4,7-8,11-14,16,18-19,21,24H,5-6,9-10,15,17,20,22H2,1-3H3,(H,36,40)(H,37,41)(H,38,42) |
| InChIKey | PAIOBHCNBVUBEJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.79 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |