C38H44N4O6S — CID 15013785
N-(cyclopentylmethyl)-1-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-3-(3-oxo-3-pyrrolidin-1-ylpropyl)indole-6-carboxamide (PubChem CID 15013785) has the molecular formula C38H44N4O6S and a molecular weight of 684.86 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-1-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-3-(3-oxo-3-pyrrolidin-1-ylpropyl)indole-6-carboxamide.
| Compound Name | N-(cyclopentylmethyl)-1-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-3-(3-oxo-3-pyrrolidin-1-ylpropyl)indole-6-carboxamide |
|---|---|
| PubChem CID | 15013785 |
| Molecular Formula | C38H44N4O6S |
| Molecular Weight | 684.86 g/mol |
| Exact Mass | 684.30 |
| IUPAC Name | N-(cyclopentylmethyl)-1-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-3-(3-oxo-3-pyrrolidin-1-ylpropyl)indole-6-carboxamide |
| SMILES | COc1cc(C(=O)NS(=O)(=O)c2ccccc2C)ccc1Cn1cc(CCC(=O)N2CCCC2)c2ccc(C(=O)NCC3CCCC3)cc21 |
| InChI | InChI=1S/C38H44N4O6S/c1-26-9-3-6-12-35(26)49(46,47)40-38(45)29-13-14-31(34(22-29)48-2)25-42-24-30(16-18-36(43)41-19-7-8-20-41)32-17-15-28(21-33(32)42)37(44)39-23-27-10-4-5-11-27/h3,6,9,12-15,17,21-22,24,27H,4-5,7-8,10-11,16,18-20,23,25H2,1-2H3,(H,39,44)(H,40,45) |
| InChIKey | ZHGHPPCUJQPKIJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.86 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |