About O-benzyl chloromethanethioate
O-benzyl chloromethanethioate (PubChem CID 15014336) has the molecular formula C8H7ClOS
and a molecular weight of 186.66 g/mol. Its IUPAC name is O-benzyl chloromethanethioate.
Molecular Properties
| Compound Name | O-benzyl chloromethanethioate |
| PubChem CID | 15014336 |
| Molecular Formula | C8H7ClOS |
| Molecular Weight | 186.66 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | O-benzyl chloromethanethioate |
| SMILES | S=C(Cl)OCc1ccccc1 |
| InChI | InChI=1S/C8H7ClOS/c9-8(11)10-6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | SFSPOXSIVFSJHM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.66 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-benzyl chloromethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-benzyl chloromethanethioate?
The IUPAC name of O-benzyl chloromethanethioate (CID 15014336) is O-benzyl chloromethanethioate.
What is the SMILES notation for O-benzyl chloromethanethioate?
The canonical SMILES for O-benzyl chloromethanethioate is S=C(Cl)OCc1ccccc1.
What is the InChIKey of O-benzyl chloromethanethioate?
The InChIKey is SFSPOXSIVFSJHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClOS/c9-8(11)10-6-7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of O-benzyl chloromethanethioate?
O-benzyl chloromethanethioate has a molecular weight of 186.66 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-benzyl chloromethanethioate is sourced from PubChem (CID 15014336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).