C5H8N4 — CID 150145288
1,2,3,4-tetrahydroimidazo[2,1-c][1,2,4]triazine (PubChem CID 150145288) has the molecular formula C5H8N4 and a molecular weight of 124.15 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroimidazo[2,1-c][1,2,4]triazine.
| Compound Name | 1,2,3,4-tetrahydroimidazo[2,1-c][1,2,4]triazine |
|---|---|
| PubChem CID | 150145288 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 1,2,3,4-tetrahydroimidazo[2,1-c][1,2,4]triazine |
| SMILES | c1cn2c(n1)NNCC2 |
| InChI | InChI=1S/C5H8N4/c1-3-9-4-2-7-8-5(9)6-1/h1,3,7H,2,4H2,(H,6,8) |
| InChIKey | FECUNGWZVBLJBA-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |