C25H32F2N4O5S — CID 150149515
tert-butyl-[(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(5-methylsulfonyl-4,5,10-triazatricyclo[6.3.0.02,6]undeca-2(6),3-dien-10-yl)oxan-3-yl]carbamic acid (PubChem CID 150149515) has the molecular formula C25H32F2N4O5S and a molecular weight of 538.62 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(5-methylsulfonyl-4,5,10-triazatricyclo[6.3.0.02,6]undeca-2(6),3-dien-10-yl)oxan-3-yl]carbamic acid.
| Compound Name | tert-butyl-[(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(5-methylsulfonyl-4,5,10-triazatricyclo[6.3.0.02,6]undeca-2(6),3-dien-10-yl)oxan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 150149515 |
| Molecular Formula | C25H32F2N4O5S |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | tert-butyl-[(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(5-methylsulfonyl-4,5,10-triazatricyclo[6.3.0.02,6]undeca-2(6),3-dien-10-yl)oxan-3-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@H]1C[C@@H](N2CC3Cc4c(cnn4S(C)(=O)=O)C3C2)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C25H32F2N4O5S/c1-25(2,3)30(24(32)33)22-9-16(13-36-23(22)17-8-15(26)5-6-20(17)27)29-11-14-7-21-18(19(14)12-29)10-28-31(21)37(4,34)35/h5-6,8,10,14,16,19,22-23H,7,9,11-13H2,1-4H3,(H,32,33)/t14?,16-,19?,22+,23-/m1/s1 |
| InChIKey | FEYOUWBGBKKVFL-PMGFMSQGSA-N |
| XLogP | 3.22 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |