C11H16O2 — CID 150149680
1,1-dimethoxy-4,5,6,7-tetrahydroindene (PubChem CID 150149680) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1,1-dimethoxy-4,5,6,7-tetrahydroindene.
| Compound Name | 1,1-dimethoxy-4,5,6,7-tetrahydroindene |
|---|---|
| PubChem CID | 150149680 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1,1-dimethoxy-4,5,6,7-tetrahydroindene |
| SMILES | COC1(OC)C=CC2=C1CCCC2 |
| InChI | InChI=1S/C11H16O2/c1-12-11(13-2)8-7-9-5-3-4-6-10(9)11/h7-8H,3-6H2,1-2H3 |
| InChIKey | FEZJZKQZORVZRF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|