About 2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide
2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide (PubChem CID 150152329) has the molecular formula C10H10BrClN4O
and a molecular weight of 317.57 g/mol. Its IUPAC name is 2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide.
Molecular Properties
| Compound Name | 2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide |
| PubChem CID | 150152329 |
| Molecular Formula | C10H10BrClN4O |
| Molecular Weight | 317.57 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide |
| SMILES | Cc1cc(C)c(NC(=O)C(Cl)N=[N+]=[N-])c(Br)c1 |
| InChI | InChI=1S/C10H10BrClN4O/c1-5-3-6(2)8(7(11)4-5)14-10(17)9(12)15-16-13/h3-4,9H,1-2H3,(H,14,17) |
| InChIKey | FFMSGQXXTUUZNJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide?
The IUPAC name of 2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide (CID 150152329) is 2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide.
What is the SMILES notation for 2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide?
The canonical SMILES for 2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide is Cc1cc(C)c(NC(=O)C(Cl)N=[N+]=[N-])c(Br)c1.
What is the InChIKey of 2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide?
The InChIKey is FFMSGQXXTUUZNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrClN4O/c1-5-3-6(2)8(7(11)4-5)14-10(17)9(12)15-16-13/h3-4,9H,1-2H3,(H,14,17).
What are the key properties of 2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide?
2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide has a molecular weight of 317.57 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-N-(2-bromo-4,6-dimethylphenyl)-2-chloroacetamide is sourced from PubChem (CID 150152329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).