About N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine
N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine (PubChem CID 150152362) has the molecular formula C17H39NO5Si
and a molecular weight of 365.59 g/mol. Its IUPAC name is N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine.
Molecular Properties
| Compound Name | N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine |
| PubChem CID | 150152362 |
| Molecular Formula | C17H39NO5Si |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine |
| SMILES | CCCCNCCC[SiH](OCC)OCC(OCC)(OCC)OCC |
| InChI | InChI=1S/C17H39NO5Si/c1-6-11-13-18-14-12-15-24(22-10-5)23-16-17(19-7-2,20-8-3)21-9-4/h18,24H,6-16H2,1-5H3 |
| InChIKey | FFMYSWZIXWBFDO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine?
The IUPAC name of N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine (CID 150152362) is N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine.
What is the SMILES notation for N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine?
The canonical SMILES for N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine is CCCCNCCC[SiH](OCC)OCC(OCC)(OCC)OCC.
What is the InChIKey of N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine?
The InChIKey is FFMYSWZIXWBFDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H39NO5Si/c1-6-11-13-18-14-12-15-24(22-10-5)23-16-17(19-7-2,20-8-3)21-9-4/h18,24H,6-16H2,1-5H3.
What are the key properties of N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine?
N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine has a molecular weight of 365.59 g/mol, XLogP of 2.80, 18 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[ethoxy(2,2,2-triethoxyethoxy)silyl]propyl]butan-1-amine is sourced from PubChem (CID 150152362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).