C18H18N2O5 — CID 150155139
2-[[4-(3-methylbut-2-enoxy)quinolin-2-yl]amino]-1,3-dioxane-4,6-dione (PubChem CID 150155139) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is 2-[[4-(3-methylbut-2-enoxy)quinolin-2-yl]amino]-1,3-dioxane-4,6-dione.
| Compound Name | 2-[[4-(3-methylbut-2-enoxy)quinolin-2-yl]amino]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 150155139 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[[4-(3-methylbut-2-enoxy)quinolin-2-yl]amino]-1,3-dioxane-4,6-dione |
| SMILES | CC(C)=CCOc1cc(NC2OC(=O)CC(=O)O2)nc2ccccc12 |
| InChI | InChI=1S/C18H18N2O5/c1-11(2)7-8-23-14-9-15(19-13-6-4-3-5-12(13)14)20-18-24-16(21)10-17(22)25-18/h3-7,9,18H,8,10H2,1-2H3,(H,19,20) |
| InChIKey | FGBPMCDPQSVVON-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|