C21H18N2O4S2 — CID 15015689
5-[[5-[3-[2-(4-methylphenyl)-1,3-oxazol-4-yl]propanoyl]thiophen-2-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 15015689) has the molecular formula C21H18N2O4S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 5-[[5-[3-[2-(4-methylphenyl)-1,3-oxazol-4-yl]propanoyl]thiophen-2-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[5-[3-[2-(4-methylphenyl)-1,3-oxazol-4-yl]propanoyl]thiophen-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 15015689 |
| Molecular Formula | C21H18N2O4S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 5-[[5-[3-[2-(4-methylphenyl)-1,3-oxazol-4-yl]propanoyl]thiophen-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(-c2nc(CCC(=O)c3ccc(CC4SC(=O)NC4=O)s3)co2)cc1 |
| InChI | InChI=1S/C21H18N2O4S2/c1-12-2-4-13(5-3-12)20-22-14(11-27-20)6-8-16(24)17-9-7-15(28-17)10-18-19(25)23-21(26)29-18/h2-5,7,9,11,18H,6,8,10H2,1H3,(H,23,25,26) |
| InChIKey | ZNFOAFSPJNWALU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|