About 3-(2,3-dimethylphenyl)oxepan-2-one
3-(2,3-dimethylphenyl)oxepan-2-one (PubChem CID 150157492) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)oxepan-2-one.
Molecular Properties
| Compound Name | 3-(2,3-dimethylphenyl)oxepan-2-one |
| PubChem CID | 150157492 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 3-(2,3-dimethylphenyl)oxepan-2-one |
| SMILES | Cc1cccc(C2CCCCOC2=O)c1C |
| InChI | InChI=1S/C14H18O2/c1-10-6-5-8-12(11(10)2)13-7-3-4-9-16-14(13)15/h5-6,8,13H,3-4,7,9H2,1-2H3 |
| InChIKey | FGNXNTNEKUJSDN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,3-dimethylphenyl)oxepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dimethylphenyl)oxepan-2-one?
The IUPAC name of 3-(2,3-dimethylphenyl)oxepan-2-one (CID 150157492) is 3-(2,3-dimethylphenyl)oxepan-2-one.
What is the SMILES notation for 3-(2,3-dimethylphenyl)oxepan-2-one?
The canonical SMILES for 3-(2,3-dimethylphenyl)oxepan-2-one is Cc1cccc(C2CCCCOC2=O)c1C.
What is the InChIKey of 3-(2,3-dimethylphenyl)oxepan-2-one?
The InChIKey is FGNXNTNEKUJSDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-10-6-5-8-12(11(10)2)13-7-3-4-9-16-14(13)15/h5-6,8,13H,3-4,7,9H2,1-2H3.
What are the key properties of 3-(2,3-dimethylphenyl)oxepan-2-one?
3-(2,3-dimethylphenyl)oxepan-2-one has a molecular weight of 218.30 g/mol, XLogP of 3.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethylphenyl)oxepan-2-one is sourced from PubChem (CID 150157492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).