About 5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine
5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine (PubChem CID 15016163) has the molecular formula C15H24ClF2N3
and a molecular weight of 319.83 g/mol. Its IUPAC name is 5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine |
| PubChem CID | 15016163 |
| Molecular Formula | C15H24ClF2N3 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine |
| SMILES | CCc1ncnc(NC(CC)CCCCCC(F)F)c1Cl |
| InChI | InChI=1S/C15H24ClF2N3/c1-3-11(8-6-5-7-9-13(17)18)21-15-14(16)12(4-2)19-10-20-15/h10-11,13H,3-9H2,1-2H3,(H,19,20,21) |
| InChIKey | YJRFIMHHAQJVLN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine?
The IUPAC name of 5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine (CID 15016163) is 5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine.
What is the SMILES notation for 5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine?
The canonical SMILES for 5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine is CCc1ncnc(NC(CC)CCCCCC(F)F)c1Cl.
What is the InChIKey of 5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine?
The InChIKey is YJRFIMHHAQJVLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24ClF2N3/c1-3-11(8-6-5-7-9-13(17)18)21-15-14(16)12(4-2)19-10-20-15/h10-11,13H,3-9H2,1-2H3,(H,19,20,21).
What are the key properties of 5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine?
5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine has a molecular weight of 319.83 g/mol, XLogP of 5.10, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(9,9-difluorononan-3-yl)-6-ethylpyrimidin-4-amine is sourced from PubChem (CID 15016163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).