About (4-acetamidophenoxy) dimethyl phosphate
(4-acetamidophenoxy) dimethyl phosphate (PubChem CID 150162176) has the molecular formula C10H14NO6P
and a molecular weight of 275.20 g/mol. Its IUPAC name is (4-acetamidophenoxy) dimethyl phosphate.
Molecular Properties
| Compound Name | (4-acetamidophenoxy) dimethyl phosphate |
| PubChem CID | 150162176 |
| Molecular Formula | C10H14NO6P |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (4-acetamidophenoxy) dimethyl phosphate |
| SMILES | COP(=O)(OC)OOc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C10H14NO6P/c1-8(12)11-9-4-6-10(7-5-9)16-17-18(13,14-2)15-3/h4-7H,1-3H3,(H,11,12) |
| InChIKey | FHRCNDRHOHMRTI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenoxy) dimethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenoxy) dimethyl phosphate?
The IUPAC name of (4-acetamidophenoxy) dimethyl phosphate (CID 150162176) is (4-acetamidophenoxy) dimethyl phosphate.
What is the SMILES notation for (4-acetamidophenoxy) dimethyl phosphate?
The canonical SMILES for (4-acetamidophenoxy) dimethyl phosphate is COP(=O)(OC)OOc1ccc(NC(C)=O)cc1.
What is the InChIKey of (4-acetamidophenoxy) dimethyl phosphate?
The InChIKey is FHRCNDRHOHMRTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14NO6P/c1-8(12)11-9-4-6-10(7-5-9)16-17-18(13,14-2)15-3/h4-7H,1-3H3,(H,11,12).
What are the key properties of (4-acetamidophenoxy) dimethyl phosphate?
(4-acetamidophenoxy) dimethyl phosphate has a molecular weight of 275.20 g/mol, XLogP of 2.36, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenoxy) dimethyl phosphate is sourced from PubChem (CID 150162176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).