C21H45NO — CID 150162386
5-(2,2,3,3-tetramethyldodecan-4-yloxy)pentan-1-amine (PubChem CID 150162386) has the molecular formula C21H45NO and a molecular weight of 327.60 g/mol. Its IUPAC name is 5-(2,2,3,3-tetramethyldodecan-4-yloxy)pentan-1-amine.
| Compound Name | 5-(2,2,3,3-tetramethyldodecan-4-yloxy)pentan-1-amine |
|---|---|
| PubChem CID | 150162386 |
| Molecular Formula | C21H45NO |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 327.35 |
| IUPAC Name | 5-(2,2,3,3-tetramethyldodecan-4-yloxy)pentan-1-amine |
| SMILES | CCCCCCCCC(OCCCCCN)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H45NO/c1-7-8-9-10-11-13-16-19(21(5,6)20(2,3)4)23-18-15-12-14-17-22/h19H,7-18,22H2,1-6H3 |
| InChIKey | FHSCNZKYQITQFC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|