1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid

C7H6F2O2 — CID 150162452

IUPAC1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1(F)C=C(F)C=CC1
InChIInChI=1S/C7H6F2O2/c8-5-2-1-3-7(9,4-5)6(10)11/h1-2,4H,3H2,(H,10,11)
InChIKeyFHSKJRRTIOAYLD-UHFFFAOYSA-N
MW160.12 g/mol
LogP1.59
Rot. Bonds1

About 1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid

1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 150162452) has the molecular formula C7H6F2O2 and a molecular weight of 160.12 g/mol. Its IUPAC name is 1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid
PubChem CID150162452
Molecular FormulaC7H6F2O2
Molecular Weight160.12 g/mol
Exact Mass160.03
IUPAC Name1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1(F)C=C(F)C=CC1
InChIInChI=1S/C7H6F2O2/c8-5-2-1-3-7(9,4-5)6(10)11/h1-2,4H,3H2,(H,10,11)
InChIKeyFHSKJRRTIOAYLD-UHFFFAOYSA-N
XLogP1.59
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.12
LogP ≤ 51.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid (CID 150162452) is 1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1(F)C=C(F)C=CC1.
What is the InChIKey of 1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is FHSKJRRTIOAYLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2O2/c8-5-2-1-3-7(9,4-5)6(10)11/h1-2,4H,3H2,(H,10,11).
What are the key properties of 1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid?
1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 160.12 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluorocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 150162452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).