About 3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate
3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate (PubChem CID 150162581) has the molecular formula C14H24O6Si
and a molecular weight of 316.43 g/mol. Its IUPAC name is 3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate.
Molecular Properties
| Compound Name | 3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate |
| PubChem CID | 150162581 |
| Molecular Formula | C14H24O6Si |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate |
| SMILES | C=C(C)C(=O)C=C(C)C(=O)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C14H24O6Si/c1-11(2)13(15)10-12(3)14(16)20-8-7-9-21(17-4,18-5)19-6/h10H,1,7-9H2,2-6H3 |
| InChIKey | FHTBFSSFMCLBGO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate?
The IUPAC name of 3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate (CID 150162581) is 3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate.
What is the SMILES notation for 3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate?
The canonical SMILES for 3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate is C=C(C)C(=O)C=C(C)C(=O)OCCC[Si](OC)(OC)OC.
What is the InChIKey of 3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate?
The InChIKey is FHTBFSSFMCLBGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O6Si/c1-11(2)13(15)10-12(3)14(16)20-8-7-9-21(17-4,18-5)19-6/h10H,1,7-9H2,2-6H3.
What are the key properties of 3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate?
3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate has a molecular weight of 316.43 g/mol, XLogP of 1.89, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethoxysilylpropyl 2,5-dimethyl-4-oxohexa-2,5-dienoate is sourced from PubChem (CID 150162581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).