C15H19NO6 — CID 15016629
prop-2-enyl (2R,3E,5R,6S)-6-[(1R)-1-hydroxyethyl]-3-(2-methoxy-2-oxoethylidene)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 15016629) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is prop-2-enyl (2R,3E,5R,6S)-6-[(1R)-1-hydroxyethyl]-3-(2-methoxy-2-oxoethylidene)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | prop-2-enyl (2R,3E,5R,6S)-6-[(1R)-1-hydroxyethyl]-3-(2-methoxy-2-oxoethylidene)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 15016629 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | prop-2-enyl (2R,3E,5R,6S)-6-[(1R)-1-hydroxyethyl]-3-(2-methoxy-2-oxoethylidene)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1/C(=C/C(=O)OC)C[C@@H]2[C@@H]([C@@H](C)O)C(=O)N21 |
| InChI | InChI=1S/C15H19NO6/c1-4-5-22-15(20)13-9(7-11(18)21-3)6-10-12(8(2)17)14(19)16(10)13/h4,7-8,10,12-13,17H,1,5-6H2,2-3H3/b9-7+/t8-,10-,12-,13-/m1/s1 |
| InChIKey | RKNHVSGZWWWTFM-CHEFVZRFSA-N |
| XLogP | -0.20 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|