C17H17NO5 — CID 15016661
benzyl (2R,3E,5R)-3-(2-methoxy-2-oxoethylidene)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 15016661) has the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. Its IUPAC name is benzyl (2R,3E,5R)-3-(2-methoxy-2-oxoethylidene)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2R,3E,5R)-3-(2-methoxy-2-oxoethylidene)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 15016661 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | benzyl (2R,3E,5R)-3-(2-methoxy-2-oxoethylidene)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)/C=C1\C[C@@H]2CC(=O)N2[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H17NO5/c1-22-15(20)8-12-7-13-9-14(19)18(13)16(12)17(21)23-10-11-5-3-2-4-6-11/h2-6,8,13,16H,7,9-10H2,1H3/b12-8+/t13-,16-/m1/s1 |
| InChIKey | BACARTUOGPRKPF-VJNRTPOASA-N |
| XLogP | 1.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|