C14H30Mg — CID 150170655
magnesium;3-ethyl-2,2,4,4-tetramethylpentane;propane (PubChem CID 150170655) has the molecular formula C14H30Mg and a molecular weight of 222.70 g/mol. Its IUPAC name is magnesium;3-ethyl-2,2,4,4-tetramethylpentane;propane.
| Compound Name | magnesium;3-ethyl-2,2,4,4-tetramethylpentane;propane |
|---|---|
| PubChem CID | 150170655 |
| Molecular Formula | C14H30Mg |
| Molecular Weight | 222.70 g/mol |
| Exact Mass | 222.22 |
| IUPAC Name | magnesium;3-ethyl-2,2,4,4-tetramethylpentane;propane |
| SMILES | CC[C-](C(C)(C)C)C(C)(C)C.[CH2-]CC.[Mg+2] |
| InChI | InChI=1S/C11H23.C3H7.Mg/c1-8-9(10(2,3)4)11(5,6)7;1-3-2;/h8H2,1-7H3;1,3H2,2H3;/q2*-1;+2 |
| InChIKey | USHNOLVTZIWSGA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.70 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|