C13H9ClF5N3O4 — CID 15017289
4-chloro-3-(3-methoxy-4-nitrophenoxy)-1-methyl-5-(1,1,2,2,2-pentafluoroethyl)pyrazole (PubChem CID 15017289) has the molecular formula C13H9ClF5N3O4 and a molecular weight of 401.68 g/mol. Its IUPAC name is 4-chloro-3-(3-methoxy-4-nitrophenoxy)-1-methyl-5-(1,1,2,2,2-pentafluoroethyl)pyrazole.
| Compound Name | 4-chloro-3-(3-methoxy-4-nitrophenoxy)-1-methyl-5-(1,1,2,2,2-pentafluoroethyl)pyrazole |
|---|---|
| PubChem CID | 15017289 |
| Molecular Formula | C13H9ClF5N3O4 |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 4-chloro-3-(3-methoxy-4-nitrophenoxy)-1-methyl-5-(1,1,2,2,2-pentafluoroethyl)pyrazole |
| SMILES | COc1cc(Oc2nn(C)c(C(F)(F)C(F)(F)F)c2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9ClF5N3O4/c1-21-10(12(15,16)13(17,18)19)9(14)11(20-21)26-6-3-4-7(22(23)24)8(5-6)25-2/h3-5H,1-2H3 |
| InChIKey | UQUAETBKGXKJEN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|